C9H5F6NO4 — CID 134663224
2-[2-oxo-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-4-yl]acetic acid (PubChem CID 134663224) has the molecular formula C9H5F6NO4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[2-oxo-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-4-yl]acetic acid.
| Compound Name | 2-[2-oxo-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-4-yl]acetic acid |
|---|---|
| PubChem CID | 134663224 |
| Molecular Formula | C9H5F6NO4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-[2-oxo-3-(trifluoromethoxy)-5-(trifluoromethyl)-1H-pyridin-4-yl]acetic acid |
| SMILES | O=C(O)Cc1c(C(F)(F)F)c[nH]c(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C9H5F6NO4/c10-8(11,12)4-2-16-7(19)6(20-9(13,14)15)3(4)1-5(17)18/h2H,1H2,(H,16,19)(H,17,18) |
| InChIKey | SKIZTLIDAXTSFT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |