C10H11F3N2O4 — CID 134666451
methyl 2-[3-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate (PubChem CID 134666451) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is methyl 2-[3-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate.
| Compound Name | methyl 2-[3-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134666451 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | methyl 2-[3-(aminomethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1[nH]cc(OC(F)(F)F)c(=O)c1CN |
| InChI | InChI=1S/C10H11F3N2O4/c1-18-8(16)2-6-5(3-14)9(17)7(4-15-6)19-10(11,12)13/h4H,2-3,14H2,1H3,(H,15,17) |
| InChIKey | BFPVNFXYAVHDAL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |