C11H11ClF3NO4 — CID 134680292
ethyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate (PubChem CID 134680292) has the molecular formula C11H11ClF3NO4 and a molecular weight of 313.66 g/mol. Its IUPAC name is ethyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate.
| Compound Name | ethyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 134680292 |
| Molecular Formula | C11H11ClF3NO4 |
| Molecular Weight | 313.66 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | ethyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c[nH]c(CCl)c(OC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H11ClF3NO4/c1-2-19-8(17)3-6-5-16-7(4-12)10(9(6)18)20-11(13,14)15/h5H,2-4H2,1H3,(H,16,18) |
| InChIKey | HHJJGQUTPOQEJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|