C10H8F5NO4 — CID 134664536
ethyl 6-(difluoromethyl)-2-oxo-4-(trifluoromethoxy)-1H-pyridine-3-carboxylate (PubChem CID 134664536) has the molecular formula C10H8F5NO4 and a molecular weight of 301.17 g/mol. Its IUPAC name is ethyl 6-(difluoromethyl)-2-oxo-4-(trifluoromethoxy)-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-(difluoromethyl)-2-oxo-4-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134664536 |
| Molecular Formula | C10H8F5NO4 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | ethyl 6-(difluoromethyl)-2-oxo-4-(trifluoromethoxy)-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC(F)(F)F)cc(C(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H8F5NO4/c1-2-19-9(18)6-5(20-10(13,14)15)3-4(7(11)12)16-8(6)17/h3,7H,2H2,1H3,(H,16,17) |
| InChIKey | BSNZDEXOCRJZIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |