C11H12N4O3S — CID 18937344
N-(diaminomethylidene)-2-ethynyl-4-methyl-5-sulfamoylbenzamide (PubChem CID 18937344) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethynyl-4-methyl-5-sulfamoylbenzamide.
| Compound Name | N-(diaminomethylidene)-2-ethynyl-4-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 18937344 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(diaminomethylidene)-2-ethynyl-4-methyl-5-sulfamoylbenzamide |
| SMILES | C#Cc1cc(C)c(S(N)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C11H12N4O3S/c1-3-7-4-6(2)9(19(14,17)18)5-8(7)10(16)15-11(12)13/h1,4-5H,2H3,(H2,14,17,18)(H4,12,13,15,16) |
| InChIKey | VCLCHPKZLVYQHA-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|