C12H12F5N3O3S — CID 18937293
N-(diaminomethylidene)-4-methyl-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzamide (PubChem CID 18937293) has the molecular formula C12H12F5N3O3S and a molecular weight of 373.30 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-methyl-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzamide.
| Compound Name | N-(diaminomethylidene)-4-methyl-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzamide |
|---|---|
| PubChem CID | 18937293 |
| Molecular Formula | C12H12F5N3O3S |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-(diaminomethylidene)-4-methyl-5-methylsulfonyl-2-(1,1,2,2,2-pentafluoroethyl)benzamide |
| SMILES | Cc1cc(C(F)(F)C(F)(F)F)c(C(=O)N=C(N)N)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H12F5N3O3S/c1-5-3-7(11(13,14)12(15,16)17)6(9(21)20-10(18)19)4-8(5)24(2,22)23/h3-4H,1-2H3,(H4,18,19,20,21) |
| InChIKey | DODBDWVRQZBKNZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|