C19H13ClFNO3S — CID 141249458
2-chloro-5-(2-fluoro-6-phenylbenzoyl)benzenesulfonamide (PubChem CID 141249458) has the molecular formula C19H13ClFNO3S and a molecular weight of 389.84 g/mol. Its IUPAC name is 2-chloro-5-(2-fluoro-6-phenylbenzoyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(2-fluoro-6-phenylbenzoyl)benzenesulfonamide |
|---|---|
| PubChem CID | 141249458 |
| Molecular Formula | C19H13ClFNO3S |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 2-chloro-5-(2-fluoro-6-phenylbenzoyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)c2c(F)cccc2-c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C19H13ClFNO3S/c20-15-10-9-13(11-17(15)26(22,24)25)19(23)18-14(7-4-8-16(18)21)12-5-2-1-3-6-12/h1-11H,(H2,22,24,25) |
| InChIKey | ZMALCODYJXVRAW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |