C17H17ClN2O3S — CID 58107415
2-chloro-5-(4-pyrrolidin-1-ylbenzoyl)benzenesulfonamide (PubChem CID 58107415) has the molecular formula C17H17ClN2O3S and a molecular weight of 364.85 g/mol. Its IUPAC name is 2-chloro-5-(4-pyrrolidin-1-ylbenzoyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(4-pyrrolidin-1-ylbenzoyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58107415 |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.85 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-chloro-5-(4-pyrrolidin-1-ylbenzoyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)c2ccc(N3CCCC3)cc2)ccc1Cl |
| InChI | InChI=1S/C17H17ClN2O3S/c18-15-8-5-13(11-16(15)24(19,22)23)17(21)12-3-6-14(7-4-12)20-9-1-2-10-20/h3-8,11H,1-2,9-10H2,(H2,19,22,23) |
| InChIKey | GNRQRVTTZAJDJB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.85 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |