C16H13ClN2O3S — CID 58107434
2-chloro-5-(1-methylindole-5-carbonyl)benzenesulfonamide (PubChem CID 58107434) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is 2-chloro-5-(1-methylindole-5-carbonyl)benzenesulfonamide.
| Compound Name | 2-chloro-5-(1-methylindole-5-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 58107434 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-chloro-5-(1-methylindole-5-carbonyl)benzenesulfonamide |
| SMILES | Cn1ccc2cc(C(=O)c3ccc(Cl)c(S(N)(=O)=O)c3)ccc21 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-19-7-6-10-8-11(3-5-14(10)19)16(20)12-2-4-13(17)15(9-12)23(18,21)22/h2-9H,1H3,(H2,18,21,22) |
| InChIKey | LYMQHQFRIUQNFX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |