C11H17FN2O2S2 — CID 114248401
4-(3-ethylsulfanylpropylamino)-3-fluorobenzenesulfonamide (PubChem CID 114248401) has the molecular formula C11H17FN2O2S2 and a molecular weight of 292.40 g/mol. Its IUPAC name is 4-(3-ethylsulfanylpropylamino)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(3-ethylsulfanylpropylamino)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 114248401 |
| Molecular Formula | C11H17FN2O2S2 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-(3-ethylsulfanylpropylamino)-3-fluorobenzenesulfonamide |
| SMILES | CCSCCCNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H17FN2O2S2/c1-2-17-7-3-6-14-11-5-4-9(8-10(11)12)18(13,15)16/h4-5,8,14H,2-3,6-7H2,1H3,(H2,13,15,16) |
| InChIKey | QORLJCQSPOTDHV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|