C11H18FN3O3S — CID 83029980
3-fluoro-4-[2-(2-methoxyethylamino)ethylamino]benzenesulfonamide (PubChem CID 83029980) has the molecular formula C11H18FN3O3S and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-fluoro-4-[2-(2-methoxyethylamino)ethylamino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[2-(2-methoxyethylamino)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 83029980 |
| Molecular Formula | C11H18FN3O3S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-fluoro-4-[2-(2-methoxyethylamino)ethylamino]benzenesulfonamide |
| SMILES | COCCNCCNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H18FN3O3S/c1-18-7-6-14-4-5-15-11-3-2-9(8-10(11)12)19(13,16)17/h2-3,8,14-15H,4-7H2,1H3,(H2,13,16,17) |
| InChIKey | SNSWNNIOTZOCSL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|