C10H14N2O5S2 — CID 67227511
4-(3-methylsulfanylpropoxy)-3-nitrobenzenesulfonamide (PubChem CID 67227511) has the molecular formula C10H14N2O5S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-(3-methylsulfanylpropoxy)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(3-methylsulfanylpropoxy)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67227511 |
| Molecular Formula | C10H14N2O5S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-(3-methylsulfanylpropoxy)-3-nitrobenzenesulfonamide |
| SMILES | CSCCCOc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N2O5S2/c1-18-6-2-5-17-10-4-3-8(19(11,15)16)7-9(10)12(13)14/h3-4,7H,2,5-6H2,1H3,(H2,11,15,16) |
| InChIKey | BGHFRNOOSMEVHY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|