C17H18ClN3O3 — CID 9251606
3-(4-chloro-2-nitroanilino)-N,N-diethylbenzamide (PubChem CID 9251606) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 3-(4-chloro-2-nitroanilino)-N,N-diethylbenzamide.
| Compound Name | 3-(4-chloro-2-nitroanilino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 9251606 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-(4-chloro-2-nitroanilino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(Nc2ccc(Cl)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-3-20(4-2)17(22)12-6-5-7-14(10-12)19-15-9-8-13(18)11-16(15)21(23)24/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | QIXUZRZDCRYMAP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|