C19H21Cl2N3O6S — CID 16877120
4-[bis(2-chloroethyl)sulfamoyl]-N-(4-ethoxy-2-nitrophenyl)benzamide (PubChem CID 16877120) has the molecular formula C19H21Cl2N3O6S and a molecular weight of 490.37 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-ethoxy-2-nitrophenyl)benzamide.
| Compound Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-ethoxy-2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 16877120 |
| Molecular Formula | C19H21Cl2N3O6S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 4-[bis(2-chloroethyl)sulfamoyl]-N-(4-ethoxy-2-nitrophenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(S(=O)(=O)N(CCCl)CCCl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21Cl2N3O6S/c1-2-30-15-5-8-17(18(13-15)24(26)27)22-19(25)14-3-6-16(7-4-14)31(28,29)23(11-9-20)12-10-21/h3-8,13H,2,9-12H2,1H3,(H,22,25) |
| InChIKey | VVNZXBSRQUAWJW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|