C20H23N3O8 — CID 30209850
2-O-[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 30209850) has the molecular formula C20H23N3O8 and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-O-[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 30209850 |
| Molecular Formula | C20H23N3O8 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-O-[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 4-O-methyl 5-ethyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2[nH]c(CC)c(C(=O)OC)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23N3O8/c1-5-13-17(19(25)29-4)11(3)18(22-13)20(26)31-10-16(24)21-14-8-7-12(30-6-2)9-15(14)23(27)28/h7-9,22H,5-6,10H2,1-4H3,(H,21,24) |
| InChIKey | MJFKRJQEWVTLCL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 149.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|