C18H18FN3O7 — CID 3626992
2-O-ethyl 4-O-[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 3626992) has the molecular formula C18H18FN3O7 and a molecular weight of 407.35 g/mol. Its IUPAC name is 2-O-ethyl 4-O-[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 3626992 |
| Molecular Formula | C18H18FN3O7 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-O-ethyl 4-O-[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)OCC(=O)Nc2ccc(F)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C18H18FN3O7/c1-4-28-18(25)16-9(2)15(10(3)20-16)17(24)29-8-14(23)21-12-6-5-11(19)7-13(12)22(26)27/h5-7,20H,4,8H2,1-3H3,(H,21,23) |
| InChIKey | NEGQWZSGPMMUQV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 140.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|