C17H16FN3O6 — CID 2699585
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2699585) has the molecular formula C17H16FN3O6 and a molecular weight of 377.33 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2699585 |
| Molecular Formula | C17H16FN3O6 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)OCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C17H16FN3O6/c1-8-15(10(3)22)9(2)19-16(8)17(24)27-7-14(23)20-11-4-5-12(18)13(6-11)21(25)26/h4-6,19H,7H2,1-3H3,(H,20,23) |
| InChIKey | XSISHDUCKCKQGJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|