C14H8Cl2FN3O5 — CID 2342714
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate (PubChem CID 2342714) has the molecular formula C14H8Cl2FN3O5 and a molecular weight of 388.14 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 2342714 |
| Molecular Formula | C14H8Cl2FN3O5 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)nc(Cl)c1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8Cl2FN3O5/c15-11-3-7(4-12(16)19-11)14(22)25-6-13(21)18-8-1-2-9(17)10(5-8)20(23)24/h1-5H,6H2,(H,18,21) |
| InChIKey | AKMBVDBOLRQMDM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|