About [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 42966204) has the molecular formula C22H17FN2O6
and a molecular weight of 424.38 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate |
| PubChem CID | 42966204 |
| Molecular Formula | C22H17FN2O6 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17FN2O6/c23-19-11-8-17(12-20(19)25(28)29)24-21(26)14-31-22(27)16-6-9-18(10-7-16)30-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,24,26) |
| InChIKey | NEEFQBPZTOUAPB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate?
The IUPAC name of [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate (CID 42966204) is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate.
What is the SMILES notation for [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate?
The canonical SMILES for [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate is O=C(COC(=O)c1ccc(OCc2ccccc2)cc1)Nc1ccc(F)c([N+](=O)[O-])c1.
What is the InChIKey of [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate?
The InChIKey is NEEFQBPZTOUAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FN2O6/c23-19-11-8-17(12-20(19)25(28)29)24-21(26)14-31-22(27)16-6-9-18(10-7-16)30-13-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,24,26).
What are the key properties of [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate?
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate has a molecular weight of 424.38 g/mol, XLogP of 4.11, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 4-phenylmethoxybenzoate is sourced from PubChem (CID 42966204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).