C17H15Cl2N3O5 — CID 9203070
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,5-dichlorobenzoate (PubChem CID 9203070) has the molecular formula C17H15Cl2N3O5 and a molecular weight of 412.23 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,5-dichlorobenzoate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 9203070 |
| Molecular Formula | C17H15Cl2N3O5 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,5-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1Cl)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15Cl2N3O5/c18-11-1-6-15(19)14(9-11)17(24)27-10-16(23)21-8-7-20-12-2-4-13(5-3-12)22(25)26/h1-6,9,20H,7-8,10H2,(H,21,23) |
| InChIKey | DFQKLONCYOOHAD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|