C17H15F2N3O5 — CID 9203381
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 9203381) has the molecular formula C17H15F2N3O5 and a molecular weight of 379.32 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 9203381 |
| Molecular Formula | C17H15F2N3O5 |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | O=C(COC(=O)c1c(F)cccc1F)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15F2N3O5/c18-13-2-1-3-14(19)16(13)17(24)27-10-15(23)21-9-8-20-11-4-6-12(7-5-11)22(25)26/h1-7,20H,8-10H2,(H,21,23) |
| InChIKey | JOSSJAOBFUAHJS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|