C21H27N3O5 — CID 9017889
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 9017889) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 9017889 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H27N3O5/c25-19(23-6-5-22-17-1-3-18(4-2-17)24(27)28)13-29-20(26)21-10-14-7-15(11-21)9-16(8-14)12-21/h1-4,14-16,22H,5-13H2,(H,23,25) |
| InChIKey | WDSVSWFLKQBOTA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|