C15H19N3O6 — CID 8808226
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] (2R)-oxolane-2-carboxylate (PubChem CID 8808226) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] (2R)-oxolane-2-carboxylate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 8808226 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] (2R)-oxolane-2-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CCCO1)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H19N3O6/c19-14(10-24-15(20)13-2-1-9-23-13)17-8-7-16-11-3-5-12(6-4-11)18(21)22/h3-6,13,16H,1-2,7-10H2,(H,17,19)/t13-/m1/s1 |
| InChIKey | HIRWABOBFVDXDO-CYBMUJFWSA-N |
| XLogP | 0.85 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|