C16H15ClN4O5 — CID 9013925
[2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 9013925) has the molecular formula C16H15ClN4O5 and a molecular weight of 378.77 g/mol. Its IUPAC name is [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9013925 |
| Molecular Formula | C16H15ClN4O5 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [2-[2-(4-nitroanilino)ethylamino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)NCCNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15ClN4O5/c17-15-13(2-1-7-20-15)16(23)26-10-14(22)19-9-8-18-11-3-5-12(6-4-11)21(24)25/h1-7,18H,8-10H2,(H,19,22) |
| InChIKey | JFRVKHOSDOKYJI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|