C20H33N5O2 — CID 78829560
2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 78829560) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 78829560 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(CC(=O)Nc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C20H33N5O2/c1-5-25(6-2)20(27)16-24-13-11-23(12-14-24)15-19(26)21-17-7-9-18(10-8-17)22(3)4/h7-10H,5-6,11-16H2,1-4H3,(H,21,26) |
| InChIKey | KPEGTVWHVDYIHZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|