C16H23N3O4 — CID 31502105
N-(5-acetamido-2-methoxyphenyl)-2-[(2R)-2-methylmorpholin-4-yl]acetamide (PubChem CID 31502105) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-2-[(2R)-2-methylmorpholin-4-yl]acetamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-2-[(2R)-2-methylmorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 31502105 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-2-[(2R)-2-methylmorpholin-4-yl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)CN1CCO[C@H](C)C1 |
| InChI | InChI=1S/C16H23N3O4/c1-11-9-19(6-7-23-11)10-16(21)18-14-8-13(17-12(2)20)4-5-15(14)22-3/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,17,20)(H,18,21)/t11-/m1/s1 |
| InChIKey | WQIZELBEQNLAMP-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |