C14H18N4O3 — CID 79663165
N-(5-amino-2-methoxyphenyl)-2-(2-cyanomorpholin-4-yl)acetamide (PubChem CID 79663165) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(5-amino-2-methoxyphenyl)-2-(2-cyanomorpholin-4-yl)acetamide.
| Compound Name | N-(5-amino-2-methoxyphenyl)-2-(2-cyanomorpholin-4-yl)acetamide |
|---|---|
| PubChem CID | 79663165 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(5-amino-2-methoxyphenyl)-2-(2-cyanomorpholin-4-yl)acetamide |
| SMILES | COc1ccc(N)cc1NC(=O)CN1CCOC(C#N)C1 |
| InChI | InChI=1S/C14H18N4O3/c1-20-13-3-2-10(16)6-12(13)17-14(19)9-18-4-5-21-11(7-15)8-18/h2-3,6,11H,4-5,8-9,16H2,1H3,(H,17,19) |
| InChIKey | GZXIRFCZSDUDMA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|