C26H26N4O — CID 46667188
2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N,2-diphenylacetamide (PubChem CID 46667188) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N,2-diphenylacetamide.
| Compound Name | 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 46667188 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N,2-diphenylacetamide |
| SMILES | N#Cc1ccc(CN2CCN(C(C(=O)Nc3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26N4O/c27-19-21-11-13-22(14-12-21)20-29-15-17-30(18-16-29)25(23-7-3-1-4-8-23)26(31)28-24-9-5-2-6-10-24/h1-14,25H,15-18,20H2,(H,28,31) |
| InChIKey | KCWXIHRKRRYFPY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |