C28H33N3O2 — CID 55505861
2-(4-benzyl-1,4-diazepan-1-yl)-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 55505861) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazepan-1-yl)-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 55505861 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2-(4-benzyl-1,4-diazepan-1-yl)-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(c1ccccc1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N3O2/c1-22-14-15-26(33-2)25(20-22)29-28(32)27(24-12-7-4-8-13-24)31-17-9-16-30(18-19-31)21-23-10-5-3-6-11-23/h3-8,10-15,20,27H,9,16-19,21H2,1-2H3,(H,29,32) |
| InChIKey | VBTDLEJIEXBRHT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |