C28H31N3O3 — CID 41169147
(2S)-2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 41169147) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is (2S)-2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 41169147 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (2S)-2-[4-(4-acetylphenyl)piperazin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](c1ccccc1)N1CCN(c2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C28H31N3O3/c1-20-9-14-26(34-3)25(19-20)29-28(33)27(23-7-5-4-6-8-23)31-17-15-30(16-18-31)24-12-10-22(11-13-24)21(2)32/h4-14,19,27H,15-18H2,1-3H3,(H,29,33)/t27-/m0/s1 |
| InChIKey | KIMKJLXQDUMLOP-MHZLTWQESA-N |
| XLogP | 4.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |