C27H31N3O4S — CID 55499047
2-[4-(benzenesulfonamido)piperidin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide (PubChem CID 55499047) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 55499047 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-(2-methoxy-5-methylphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)C(c1ccccc1)N1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H31N3O4S/c1-20-13-14-25(34-2)24(19-20)28-27(31)26(21-9-5-3-6-10-21)30-17-15-22(16-18-30)29-35(32,33)23-11-7-4-8-12-23/h3-14,19,22,26,29H,15-18H2,1-2H3,(H,28,31) |
| InChIKey | MOVDKENPIUYQJU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |