C24H30N4O — CID 9399043
(2S)-N-benzyl-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-ethylpropanamide (PubChem CID 9399043) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-ethylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 9399043 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2S)-N-benzyl-2-[4-[(4-cyanophenyl)methyl]piperazin-1-yl]-N-ethylpropanamide |
| SMILES | CCN(Cc1ccccc1)C(=O)[C@H](C)N1CCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-3-27(19-22-7-5-4-6-8-22)24(29)20(2)28-15-13-26(14-16-28)18-23-11-9-21(17-25)10-12-23/h4-12,20H,3,13-16,18-19H2,1-2H3/t20-/m0/s1 |
| InChIKey | MTXRNPHGPYLHBH-FQEVSTJZSA-N |
| XLogP | 3.11 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |