C23H26N4O — CID 156839415
(3S,4R)-N-[1-(4-cyanophenyl)piperidin-4-yl]-4-phenylpyrrolidine-3-carboxamide (PubChem CID 156839415) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is (3S,4R)-N-[1-(4-cyanophenyl)piperidin-4-yl]-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-N-[1-(4-cyanophenyl)piperidin-4-yl]-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 156839415 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (3S,4R)-N-[1-(4-cyanophenyl)piperidin-4-yl]-4-phenylpyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccc(N2CCC(NC(=O)[C@@H]3CNC[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H26N4O/c24-14-17-6-8-20(9-7-17)27-12-10-19(11-13-27)26-23(28)22-16-25-15-21(22)18-4-2-1-3-5-18/h1-9,19,21-22,25H,10-13,15-16H2,(H,26,28)/t21-,22+/m0/s1 |
| InChIKey | MMZCMIHXNPYKQV-FCHUYYIVSA-N |
| XLogP | 2.65 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |