C26H27N5O2 — CID 86880901
1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]urea (PubChem CID 86880901) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]urea.
| Compound Name | 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 86880901 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]urea |
| SMILES | N#Cc1ccc(N2CCC(NC(=O)NCc3ccc(Cn4ccccc4=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27N5O2/c27-17-20-8-10-24(11-9-20)30-15-12-23(13-16-30)29-26(33)28-18-21-4-6-22(7-5-21)19-31-14-2-1-3-25(31)32/h1-11,14,23H,12-13,15-16,18-19H2,(H2,28,29,33) |
| InChIKey | FHMUEQKEEPGNLH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |