C23H33N5OS — CID 86873399
1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea (PubChem CID 86873399) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea.
| Compound Name | 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 86873399 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-[1-(4-cyanophenyl)piperidin-4-yl]-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
| SMILES | N#Cc1ccc(N2CCC(NC(=O)NCC3(N4CCSCC4)CCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H33N5OS/c24-17-19-3-5-21(6-4-19)27-11-7-20(8-12-27)26-22(29)25-18-23(9-1-2-10-23)28-13-15-30-16-14-28/h3-6,20H,1-2,7-16,18H2,(H2,25,26,29) |
| InChIKey | OUFWHYZJOPNMEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |