C18H24N4OS — CID 38281830
1-(4-cyanophenyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea (PubChem CID 38281830) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 38281830 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NCC2(N3CCSCC3)CCCC2)cc1 |
| InChI | InChI=1S/C18H24N4OS/c19-13-15-3-5-16(6-4-15)21-17(23)20-14-18(7-1-2-8-18)22-9-11-24-12-10-22/h3-6H,1-2,7-12,14H2,(H2,20,21,23) |
| InChIKey | NHKFAIZJORPBFM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |