C21H30N2O2S — CID 36554858
4-(4-methylphenyl)-4-oxo-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide (PubChem CID 36554858) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide |
|---|---|
| PubChem CID | 36554858 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCC2(N3CCSCC3)CCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O2S/c1-17-4-6-18(7-5-17)19(24)8-9-20(25)22-16-21(10-2-3-11-21)23-12-14-26-15-13-23/h4-7H,2-3,8-16H2,1H3,(H,22,25) |
| InChIKey | KVQKHFJXHQGVMR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |