C22H34N2O3S — CID 17475695
3-(4-methylphenyl)sulfonyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide (PubChem CID 17475695) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 17475695 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)NCC2(N3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C22H34N2O3S/c1-19-8-10-20(11-9-19)28(26,27)17-12-21(25)23-18-22(13-4-2-5-14-22)24-15-6-3-7-16-24/h8-11H,2-7,12-18H2,1H3,(H,23,25) |
| InChIKey | UYILMWIAGSNWKP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |