C18H28N2O4S — CID 120890633
N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 120890633) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 120890633 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[[4-(methoxymethyl)piperidin-4-yl]methyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | COCC1(CNC(=O)CCS(=O)(=O)c2ccc(C)cc2)CCNCC1 |
| InChI | InChI=1S/C18H28N2O4S/c1-15-3-5-16(6-4-15)25(22,23)12-7-17(21)20-13-18(14-24-2)8-10-19-11-9-18/h3-6,19H,7-14H2,1-2H3,(H,20,21) |
| InChIKey | UBSHQMUTNLWLCJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |