C21H33N3O4S2 — CID 39179857
3-[(4-ethoxyphenyl)sulfonylamino]-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]propanamide (PubChem CID 39179857) has the molecular formula C21H33N3O4S2 and a molecular weight of 455.65 g/mol. Its IUPAC name is 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]propanamide.
| Compound Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]propanamide |
|---|---|
| PubChem CID | 39179857 |
| Molecular Formula | C21H33N3O4S2 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-[(4-ethoxyphenyl)sulfonylamino]-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(=O)NCC2(N3CCSCC3)CCCC2)cc1 |
| InChI | InChI=1S/C21H33N3O4S2/c1-2-28-18-5-7-19(8-6-18)30(26,27)23-12-9-20(25)22-17-21(10-3-4-11-21)24-13-15-29-16-14-24/h5-8,23H,2-4,9-17H2,1H3,(H,22,25) |
| InChIKey | ZLARPSPETCGVNX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |