C19H24ClN3O2 — CID 119303149
N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119303149) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119303149 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCc1ccc(Cn2ccccc2=O)cc1)C1CCCCN1 |
| InChI | InChI=1S/C19H23N3O2.ClH/c23-18-6-2-4-12-22(18)14-16-9-7-15(8-10-16)13-21-19(24)17-5-1-3-11-20-17;/h2,4,6-10,12,17,20H,1,3,5,11,13-14H2,(H,21,24);1H |
| InChIKey | VKFMURZZJBEJCO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |