C17H23N3O4S — CID 9223139
2-(4-benzoylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 9223139) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 9223139 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2)CC1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23N3O4S/c21-16(18-15-6-11-25(23,24)13-15)12-19-7-9-20(10-8-19)17(22)14-4-2-1-3-5-14/h1-5,15H,6-13H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | RNYJQVDUYCWHAX-OAHLLOKOSA-N |
| XLogP | -0.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |