C18H34N4O3S — CID 111734179
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]propanamide (PubChem CID 111734179) has the molecular formula C18H34N4O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111734179 |
| Molecular Formula | C18H34N4O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-[3-(2-methylpropyl)pyrrolidin-1-yl]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N1CCC(CC(C)C)C1 |
| InChI | InChI=1S/C18H34N4O3S/c1-4-19-18(22-9-6-15(12-22)11-14(2)3)20-8-5-17(23)21-16-7-10-26(24,25)13-16/h14-16H,4-13H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | TXEAEYYRXGPPRU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|