C19H34N4O3S — CID 111744486
3-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 111744486) has the molecular formula C19H34N4O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 111744486 |
| Molecular Formula | C19H34N4O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 3-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C19H34N4O3S/c1-2-20-18(23-12-10-19(15-23)8-4-3-5-9-19)21-11-6-17(24)22-16-7-13-27(25,26)14-16/h16H,2-15H2,1H3,(H,20,21)(H,22,24) |
| InChIKey | CEMFEVDMWQHQBZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|