C21H33IN4O4S — CID 109428184
N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]propanamide;hydroiodide (PubChem CID 109428184) has the molecular formula C21H33IN4O4S and a molecular weight of 564.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109428184 |
| Molecular Formula | C21H33IN4O4S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[[ethylamino-(4-phenoxypiperidin-1-yl)methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H32N4O4S.HI/c1-2-22-21(23-12-8-20(26)24-17-11-15-30(27,28)16-17)25-13-9-19(10-14-25)29-18-6-4-3-5-7-18;/h3-7,17,19H,2,8-16H2,1H3,(H,22,23)(H,24,26);1H |
| InChIKey | ASIXTRQAVHOTOM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|