C15H30N4OS — CID 109489681
3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylpropanamide (PubChem CID 109489681) has the molecular formula C15H30N4OS and a molecular weight of 314.50 g/mol. Its IUPAC name is 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 109489681 |
| Molecular Formula | C15H30N4OS |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]-N-propan-2-ylpropanamide |
| SMILES | CCN/C(=N\CCC(=O)NC(C)C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C15H30N4OS/c1-6-16-14(17-8-7-13(20)18-12(2)3)19-9-10-21-15(4,5)11-19/h12H,6-11H2,1-5H3,(H,16,17)(H,18,20) |
| InChIKey | SBLXGNDPRMKTKZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|