C15H29N3O2S — CID 109487441
ethyl 4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanoate (PubChem CID 109487441) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is ethyl 4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 109487441 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | ethyl 4-[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]butanoate |
| SMILES | CCN/C(=N\CCCC(=O)OCC)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C15H29N3O2S/c1-5-16-14(17-9-7-8-13(19)20-6-2)18-10-11-21-15(3,4)12-18/h5-12H2,1-4H3,(H,16,17) |
| InChIKey | MOJNVMPOLTVVPY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|