C14H28N4S — CID 109489411
N',2,2-trimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109489411) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489411 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N',2,2-trimethyl-N-[(1-methylpyrrolidin-2-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCC1CCCN1C)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C14H28N4S/c1-14(2)11-18(8-9-19-14)13(15-3)16-10-12-6-5-7-17(12)4/h12H,5-11H2,1-4H3,(H,15,16) |
| InChIKey | KCTQUNFAWJTBMW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|