C17H34IN5OS — CID 109487444
1-[3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 109487444) has the molecular formula C17H34IN5OS and a molecular weight of 483.46 g/mol. Its IUPAC name is 1-[3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109487444 |
| Molecular Formula | C17H34IN5OS |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-[3-[[C-(2,2-dimethylthiomorpholin-4-yl)-N-methylcarbonimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCN1CCCC(C(N)=O)C1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C17H33N5OS.HI/c1-17(2)13-22(10-11-24-17)16(19-3)20-7-5-9-21-8-4-6-14(12-21)15(18)23;/h14H,4-13H2,1-3H3,(H2,18,23)(H,19,20);1H |
| InChIKey | USDJSOXJDYRDKB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|