C13H24IN5OS — CID 109485307
N,2-diethyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485307) has the molecular formula C13H24IN5OS and a molecular weight of 425.34 g/mol. Its IUPAC name is N,2-diethyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N,2-diethyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485307 |
| Molecular Formula | C13H24IN5OS |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N,2-diethyl-N'-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)N1CCSC(CC)C1.I |
| InChI | InChI=1S/C13H23N5OS.HI/c1-4-11-9-18(6-7-20-11)13(14-5-2)15-8-12-16-10(3)19-17-12;/h11H,4-9H2,1-3H3,(H,14,15);1H |
| InChIKey | ZHQIWSIRFIEDHS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|